C12H17NO2S — CID 104957425
N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylthiophene-2-carboxamide (PubChem CID 104957425) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 104957425 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CCCC[C@@H]2O)s1 |
| InChI | InChI=1S/C12H17NO2S/c1-8-6-7-11(16-8)12(15)13-9-4-2-3-5-10(9)14/h6-7,9-10,14H,2-5H2,1H3,(H,13,15)/t9-,10-/m0/s1 |
| InChIKey | KPELEECPSZWMNP-UWVGGRQHSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |