C15H20N2O5 — CID 124522304
2-[(4aR,7S,7aR)-7-[(furan-2-carbonylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid (PubChem CID 124522304) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[(4aR,7S,7aR)-7-[(furan-2-carbonylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid.
| Compound Name | 2-[(4aR,7S,7aR)-7-[(furan-2-carbonylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 124522304 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[(4aR,7S,7aR)-7-[(furan-2-carbonylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid |
| SMILES | O=C(O)CN1CCO[C@@H]2[C@H](CNC(=O)c3ccco3)CC[C@H]21 |
| InChI | InChI=1S/C15H20N2O5/c18-13(19)9-17-5-7-22-14-10(3-4-11(14)17)8-16-15(20)12-2-1-6-21-12/h1-2,6,10-11,14H,3-5,7-9H2,(H,16,20)(H,18,19)/t10-,11+,14+/m0/s1 |
| InChIKey | QBHGASHMIFSZRP-MISXGVKJSA-N |
| XLogP | 0.57 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |