C21H28F3N3O5 — CID 171695644
(4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-7-(3-pyrazol-1-ylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 171695644) has the molecular formula C21H28F3N3O5 and a molecular weight of 459.47 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-7-(3-pyrazol-1-ylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-7-(3-pyrazol-1-ylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171695644 |
| Molecular Formula | C21H28F3N3O5 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-7-(3-pyrazol-1-ylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCO[C@H]3[C@H](OCCCn4cccn4)CC[C@@H]32)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N3O3.C2HF3O2/c1-15-4-5-16(25-15)14-21-11-13-24-19-17(21)6-7-18(19)23-12-3-10-22-9-2-8-20-22;3-2(4,5)1(6)7/h2,4-5,8-9,17-19H,3,6-7,10-14H2,1H3;(H,6,7)/t17-,18+,19+;/m0./s1 |
| InChIKey | NADONNYTYYKPFB-JQPLGUQCSA-N |
| XLogP | 3.26 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|