C19H28N2O4 — CID 97365493
2-[[(4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone (PubChem CID 97365493) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[[(4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[(4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 97365493 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[[(4aS,7R,7aR)-4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1ccc(CN2CCO[C@H]3[C@H](OCC(=O)N4CCCC4)CC[C@@H]32)o1 |
| InChI | InChI=1S/C19H28N2O4/c1-14-4-5-15(25-14)12-21-10-11-23-19-16(21)6-7-17(19)24-13-18(22)20-8-2-3-9-20/h4-5,16-17,19H,2-3,6-13H2,1H3/t16-,17+,19+/m0/s1 |
| InChIKey | TYMRFMLGYZBNHG-YQVWRLOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |