C21H26F6N4O5 — CID 155863916
4-[(1-methylpyrazol-4-yl)methyl]-7-(pyrrol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155863916) has the molecular formula C21H26F6N4O5 and a molecular weight of 528.45 g/mol. Its IUPAC name is 4-[(1-methylpyrazol-4-yl)methyl]-7-(pyrrol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[(1-methylpyrazol-4-yl)methyl]-7-(pyrrol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155863916 |
| Molecular Formula | C21H26F6N4O5 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 4-[(1-methylpyrazol-4-yl)methyl]-7-(pyrrol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CCOC3C(Cn4cccc4)CCC32)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O.2C2HF3O2/c1-19-11-14(10-18-19)12-21-8-9-22-17-15(4-5-16(17)21)13-20-6-2-3-7-20;2*3-2(4,5)1(6)7/h2-3,6-7,10-11,15-17H,4-5,8-9,12-13H2,1H3;2*(H,6,7) |
| InChIKey | QSTBAVBNKOUHOQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |