C20H28F3N3O6 — CID 171694401
(3aR,5R,7aR)-N-(2-methoxyethyl)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171694401) has the molecular formula C20H28F3N3O6 and a molecular weight of 463.45 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-(2-methoxyethyl)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N-(2-methoxyethyl)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694401 |
| Molecular Formula | C20H28F3N3O6 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (3aR,5R,7aR)-N-(2-methoxyethyl)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@H]1CC[C@@H]2[C@@H](CCN2Cc2cccnc2OC)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O4.C2HF3O2/c1-23-11-9-19-17(22)16-6-5-14-15(25-16)7-10-21(14)12-13-4-3-8-20-18(13)24-2;3-2(4,5)1(6)7/h3-4,8,14-16H,5-7,9-12H2,1-2H3,(H,19,22);(H,6,7)/t14-,15-,16-;/m1./s1 |
| InChIKey | IIOXFBQFJAHCOF-UDHFTORSSA-N |
| XLogP | 1.61 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|