C19H24F6N2O6 — CID 127023036
(3aR,5R,7aR)-5-(methoxymethyl)-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023036) has the molecular formula C19H24F6N2O6 and a molecular weight of 490.40 g/mol. Its IUPAC name is (3aR,5R,7aR)-5-(methoxymethyl)-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,5R,7aR)-5-(methoxymethyl)-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023036 |
| Molecular Formula | C19H24F6N2O6 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (3aR,5R,7aR)-5-(methoxymethyl)-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COC[C@H]1CC[C@@H]2[C@@H](CCN2Cc2ccccn2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O2.2C2HF3O2/c1-18-11-13-5-6-14-15(19-13)7-9-17(14)10-12-4-2-3-8-16-12;2*3-2(4,5)1(6)7/h2-4,8,13-15H,5-7,9-11H2,1H3;2*(H,6,7)/t13-,14-,15-;;/m1../s1 |
| InChIKey | YXKMXJUDKYAWGV-CRCLDWEMSA-N |
| XLogP | 3.12 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |