C19H23F3N2O4 — CID 155851289
3-[[(3aS,5R,7aS)-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile;2,2,2-trifluoroacetic acid (PubChem CID 155851289) has the molecular formula C19H23F3N2O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is 3-[[(3aS,5R,7aS)-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3aS,5R,7aS)-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851289 |
| Molecular Formula | C19H23F3N2O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-[[(3aS,5R,7aS)-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile;2,2,2-trifluoroacetic acid |
| SMILES | COC[C@H]1CC[C@H]2[C@H](CCN2Cc2cccc(C#N)c2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N2O2.C2HF3O2/c1-20-12-15-5-6-16-17(21-15)7-8-19(16)11-14-4-2-3-13(9-14)10-18;3-2(4,5)1(6)7/h2-4,9,15-17H,5-8,11-12H2,1H3;(H,6,7)/t15-,16+,17+;/m1./s1 |
| InChIKey | CLUADLHFDIBUGD-LPZNKSAJSA-N |
| XLogP | 2.96 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |