C16H22FNO2 — CID 97379119
(3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97379119) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97379119 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(methoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | COC[C@H]1CC[C@@H]2[C@@H](CCN2Cc2ccc(F)cc2)O1 |
| InChI | InChI=1S/C16H22FNO2/c1-19-11-14-6-7-15-16(20-14)8-9-18(15)10-12-2-4-13(17)5-3-12/h2-5,14-16H,6-11H2,1H3/t14-,15-,16-/m1/s1 |
| InChIKey | OGHVEFSYHCSWDB-BZUAXINKSA-N |
| XLogP | 2.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |