C24H33F6N3O6 — CID 171693661
(3aS,5R,7aS)-1-(pyridin-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171693661) has the molecular formula C24H33F6N3O6 and a molecular weight of 573.53 g/mol. Its IUPAC name is (3aS,5R,7aS)-1-(pyridin-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,5R,7aS)-1-(pyridin-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171693661 |
| Molecular Formula | C24H33F6N3O6 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | (3aS,5R,7aS)-1-(pyridin-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(CN2CC[C@@H]3O[C@@H](COCCN4CCCC4)CC[C@@H]32)nc1 |
| InChI | InChI=1S/C20H31N3O2.2C2HF3O2/c1-2-9-21-17(5-1)15-23-12-8-20-19(23)7-6-18(25-20)16-24-14-13-22-10-3-4-11-22;2*3-2(4,5)1(6)7/h1-2,5,9,18-20H,3-4,6-8,10-16H2;2*(H,6,7)/t18-,19+,20+;;/m1../s1 |
| InChIKey | AJBCDLSMNVRGBI-SPUMIKHOSA-N |
| XLogP | 3.58 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|