C19H30N2O3 — CID 133142108
(3aR,5S,7aR)-1-(furan-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 133142108) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3aR,5S,7aR)-1-(furan-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aR,5S,7aR)-1-(furan-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 133142108 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (3aR,5S,7aR)-1-(furan-2-ylmethyl)-5-(2-pyrrolidin-1-ylethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1coc(CN2CC[C@H]3O[C@H](COCCN4CCCC4)CC[C@H]32)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-2-9-20(8-1)11-13-22-15-17-5-6-18-19(24-17)7-10-21(18)14-16-4-3-12-23-16/h3-4,12,17-19H,1-2,5-11,13-15H2/t17-,18+,19+/m0/s1 |
| InChIKey | QCQKIHWJWBJSLM-IPMKNSEASA-N |
| XLogP | 2.51 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|