C21H25F4N3O5 — CID 155866693
(3aR,5R,7aR)-1-(1-fluorocyclobutanecarbonyl)-N-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155866693) has the molecular formula C21H25F4N3O5 and a molecular weight of 475.44 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-(1-fluorocyclobutanecarbonyl)-N-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-1-(1-fluorocyclobutanecarbonyl)-N-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866693 |
| Molecular Formula | C21H25F4N3O5 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (3aR,5R,7aR)-1-(1-fluorocyclobutanecarbonyl)-N-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cccnc1)[C@H]1CC[C@@H]2[C@@H](CCN2C(=O)C2(F)CCC2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24FN3O3.C2HF3O2/c20-19(7-2-8-19)18(25)23-10-6-15-14(23)4-5-16(26-15)17(24)22-12-13-3-1-9-21-11-13;3-2(4,5)1(6)7/h1,3,9,11,14-16H,2,4-8,10,12H2,(H,22,24);(H,6,7)/t14-,15-,16-;/m1./s1 |
| InChIKey | FEKGQFKLQZPRIZ-UDHFTORSSA-N |
| XLogP | 2.37 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |