C23H25F6N3O6S — CID 155849637
(2S,3aS,7aR)-N-(pyridin-3-ylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155849637) has the molecular formula C23H25F6N3O6S and a molecular weight of 585.52 g/mol. Its IUPAC name is (2S,3aS,7aR)-N-(pyridin-3-ylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,3aS,7aR)-N-(pyridin-3-ylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155849637 |
| Molecular Formula | C23H25F6N3O6S |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | (2S,3aS,7aR)-N-(pyridin-3-ylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NCc1cccnc1)[C@@H]1C[C@@H]2CCN(Cc3ccsc3)C[C@@H]2O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N3O2S.2C2HF3O2/c23-19(21-10-14-2-1-5-20-9-14)17-8-16-3-6-22(12-18(16)24-17)11-15-4-7-25-13-15;2*3-2(4,5)1(6)7/h1-2,4-5,7,9,13,16-18H,3,6,8,10-12H2,(H,21,23);2*(H,6,7)/t16-,17-,18-;;/m0../s1 |
| InChIKey | PVMRYEIDJFXLJM-ZUIPZQNBSA-N |
| XLogP | 3.71 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |