C22H23F6N3O6S — CID 155831087
(3R,3aS,6aS)-N-(pyridin-3-ylmethyl)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155831087) has the molecular formula C22H23F6N3O6S and a molecular weight of 571.50 g/mol. Its IUPAC name is (3R,3aS,6aS)-N-(pyridin-3-ylmethyl)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aS,6aS)-N-(pyridin-3-ylmethyl)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155831087 |
| Molecular Formula | C22H23F6N3O6S |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | (3R,3aS,6aS)-N-(pyridin-3-ylmethyl)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NCc1cccnc1)[C@H]1CO[C@@H]2CN(Cc3ccsc3)C[C@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3O2S.2C2HF3O2/c22-18(20-7-13-2-1-4-19-6-13)16-11-23-17-10-21(9-15(16)17)8-14-3-5-24-12-14;2*3-2(4,5)1(6)7/h1-6,12,15-17H,7-11H2,(H,20,22);2*(H,6,7)/t15-,16+,17-;;/m1../s1 |
| InChIKey | OQUIVJOFAODOEN-VVEZYYRQSA-N |
| XLogP | 3.17 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |