C17H23F3N2O4 — CID 171693321
(3R,3aR,6aR)-3-(2-methoxyethyl)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 171693321) has the molecular formula C17H23F3N2O4 and a molecular weight of 376.38 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-(2-methoxyethyl)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aR)-3-(2-methoxyethyl)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171693321 |
| Molecular Formula | C17H23F3N2O4 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (3R,3aR,6aR)-3-(2-methoxyethyl)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | COCC[C@H]1CO[C@H]2CN(Cc3cccnc3)C[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O2.C2HF3O2/c1-18-6-4-13-11-19-15-10-17(9-14(13)15)8-12-3-2-5-16-7-12;3-2(4,5)1(6)7/h2-3,5,7,13-15H,4,6,8-11H2,1H3;(H,6,7)/t13-,14-,15-;/m0./s1 |
| InChIKey | NVMFXORQQROTOO-WDTSGDEMSA-N |
| XLogP | 2.20 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |