C23H28F6N4O6 — CID 155839609
(3R,3aR,6aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155839609) has the molecular formula C23H28F6N4O6 and a molecular weight of 570.49 g/mol. Its IUPAC name is (3R,3aR,6aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aR,6aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155839609 |
| Molecular Formula | C23H28F6N4O6 |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | (3R,3aR,6aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCn1cc(CN2C[C@H]3[C@@H](CCOc4ccccn4)CO[C@H]3C2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N4O2.2C2HF3O2/c1-2-23-11-15(9-21-23)10-22-12-17-16(14-25-18(17)13-22)6-8-24-19-5-3-4-7-20-19;2*3-2(4,5)1(6)7/h3-5,7,9,11,16-18H,2,6,8,10,12-14H2,1H3;2*(H,6,7)/t16-,17-,18-;;/m0../s1 |
| InChIKey | VYAKJIQSGQXUGY-ZUIPZQNBSA-N |
| XLogP | 3.48 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |