C18H22N4O3 — CID 133142960
[(3S,3aS,6aS)-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 133142960) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is [(3S,3aS,6aS)-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [(3S,3aS,6aS)-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 133142960 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(3S,3aS,6aS)-3-(2-pyridin-2-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1C[C@@H]2[C@H](CCOc3ccccn3)CO[C@@H]2C1 |
| InChI | InChI=1S/C18H22N4O3/c1-21-15(5-8-20-21)18(23)22-10-14-13(12-25-16(14)11-22)6-9-24-17-4-2-3-7-19-17/h2-5,7-8,13-14,16H,6,9-12H2,1H3/t13-,14-,16-/m1/s1 |
| InChIKey | HFSVUPADCUBCLC-IIAWOOMASA-N |
| XLogP | 1.37 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |