C18H18N4O3S — CID 124784620
6-[2-[(3S,3aS,6aS)-5-(1,3-thiazole-4-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile (PubChem CID 124784620) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 6-[2-[(3S,3aS,6aS)-5-(1,3-thiazole-4-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[(3S,3aS,6aS)-5-(1,3-thiazole-4-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 124784620 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 6-[2-[(3S,3aS,6aS)-5-(1,3-thiazole-4-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(OCC[C@@H]2CO[C@@H]3CN(C(=O)c4cscn4)C[C@H]23)nc1 |
| InChI | InChI=1S/C18H18N4O3S/c19-5-12-1-2-17(20-6-12)24-4-3-13-9-25-16-8-22(7-14(13)16)18(23)15-10-26-11-21-15/h1-2,6,10-11,13-14,16H,3-4,7-9H2/t13-,14-,16-/m1/s1 |
| InChIKey | RCHSOILXRKPGNU-IIAWOOMASA-N |
| XLogP | 1.97 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |