C18H20N4O3 — CID 124790727
[(3R,3aR,6aR)-3-(2-pyridin-3-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyrazin-2-ylmethanone (PubChem CID 124790727) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(3R,3aR,6aR)-3-(2-pyridin-3-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3R,3aR,6aR)-3-(2-pyridin-3-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 124790727 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(3R,3aR,6aR)-3-(2-pyridin-3-yloxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1C[C@H]2[C@@H](CCOc3cccnc3)CO[C@H]2C1 |
| InChI | InChI=1S/C18H20N4O3/c23-18(16-9-20-5-6-21-16)22-10-15-13(12-25-17(15)11-22)3-7-24-14-2-1-4-19-8-14/h1-2,4-6,8-9,13,15,17H,3,7,10-12H2/t13-,15-,17-/m0/s1 |
| InChIKey | DWTPAGFDSMERTJ-QRTARXTBSA-N |
| XLogP | 1.43 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |