C20H23N3O2 — CID 124820934
[(3S,3aR,6aR)-3-[(pyridin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylphenyl)methanone (PubChem CID 124820934) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is [(3S,3aR,6aR)-3-[(pyridin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylphenyl)methanone.
| Compound Name | [(3S,3aR,6aR)-3-[(pyridin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 124820934 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [(3S,3aR,6aR)-3-[(pyridin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1C[C@H]2[C@@H](CNc3ccccn3)CO[C@H]2C1 |
| InChI | InChI=1S/C20H23N3O2/c1-14-6-2-3-7-16(14)20(24)23-11-17-15(13-25-18(17)12-23)10-22-19-8-4-5-9-21-19/h2-9,15,17-18H,10-13H2,1H3,(H,21,22)/t15-,17-,18-/m0/s1 |
| InChIKey | LLRICIRCWFZCAX-SZMVWBNQSA-N |
| XLogP | 2.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |