C19H20N4O4 — CID 124803622
[(3R,3aR,6aR)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 124803622) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(3R,3aR,6aR)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [(3R,3aR,6aR)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 124803622 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(3R,3aR,6aR)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1C[C@H]2[C@H](CNc3ncccn3)CO[C@H]2C1 |
| InChI | InChI=1S/C19H20N4O4/c24-18(12-2-3-15-16(6-12)27-11-26-15)23-8-14-13(10-25-17(14)9-23)7-22-19-20-4-1-5-21-19/h1-6,13-14,17H,7-11H2,(H,20,21,22)/t13-,14+,17+/m1/s1 |
| InChIKey | YZWALQQOTUPYJR-KEYYUXOJSA-N |
| XLogP | 1.40 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |