C16H22N4O2 — CID 124794423
[(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone (PubChem CID 124794423) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone.
| Compound Name | [(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 124794423 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1C[C@@H]2[C@@H](CNc3ncccn3)CO[C@@H]2C1 |
| InChI | InChI=1S/C16H22N4O2/c21-15(11-3-1-4-11)20-8-13-12(10-22-14(13)9-20)7-19-16-17-5-2-6-18-16/h2,5-6,11-14H,1,3-4,7-10H2,(H,17,18,19)/t12-,13+,14+/m0/s1 |
| InChIKey | MJSQQZSMLZZICF-BFHYXJOUSA-N |
| XLogP | 1.16 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |