C20H26N4O3 — CID 124798948
N-[[(3R,3aR,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine (PubChem CID 124798948) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[[(3R,3aR,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine.
| Compound Name | N-[[(3R,3aR,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 124798948 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[[(3R,3aR,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine |
| SMILES | COc1cc(CN2C[C@H]3[C@H](CNc4ncccn4)CO[C@H]3C2)cc(OC)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-25-16-6-14(7-17(8-16)26-2)10-24-11-18-15(13-27-19(18)12-24)9-23-20-21-4-3-5-22-20/h3-8,15,18-19H,9-13H2,1-2H3,(H,21,22,23)/t15-,18+,19+/m1/s1 |
| InChIKey | WQDFTVFHPYANBS-MNEFBYGVSA-N |
| XLogP | 2.05 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |