C19H26N2O3 — CID 155875945
[(3R,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 155875945) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [(3R,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3R,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 155875945 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [(3R,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1cccc(CN2C[C@@H]3[C@@H](C(=O)N4CCCC4)CO[C@@H]3C2)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-23-15-6-4-5-14(9-15)10-20-11-16-17(13-24-18(16)12-20)19(22)21-7-2-3-8-21/h4-6,9,16-18H,2-3,7-8,10-13H2,1H3/t16-,17+,18-/m1/s1 |
| InChIKey | YQEMEJNTTKNOHY-FGTMMUONSA-N |
| XLogP | 1.76 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |