C21H25N3O3 — CID 155875444
(3aS,4R,7aS)-6-[(3-methoxyphenyl)methyl]-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide (PubChem CID 155875444) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3aS,4R,7aS)-6-[(3-methoxyphenyl)methyl]-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide.
| Compound Name | (3aS,4R,7aS)-6-[(3-methoxyphenyl)methyl]-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155875444 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (3aS,4R,7aS)-6-[(3-methoxyphenyl)methyl]-N-pyridin-3-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
| SMILES | COc1cccc(CN2C[C@H](C(=O)Nc3cccnc3)[C@@H]3CCO[C@@H]3C2)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-26-17-6-2-4-15(10-17)12-24-13-19(18-7-9-27-20(18)14-24)21(25)23-16-5-3-8-22-11-16/h2-6,8,10-11,18-20H,7,9,12-14H2,1H3,(H,23,25)/t18-,19-,20+/m0/s1 |
| InChIKey | KFIBTOLHSXPDGI-SLFFLAALSA-N |
| XLogP | 2.57 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |