C20H30N2O4 — CID 133142087
2-[2-[(3S,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]-N,N-dimethylacetamide (PubChem CID 133142087) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[2-[(3S,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-[(3S,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 133142087 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[2-[(3S,3aS,6aS)-5-[(3-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]-N,N-dimethylacetamide |
| SMILES | COc1cccc(CN2C[C@@H]3[C@H](CCOCC(=O)N(C)C)CO[C@@H]3C2)c1 |
| InChI | InChI=1S/C20H30N2O4/c1-21(2)20(23)14-25-8-7-16-13-26-19-12-22(11-18(16)19)10-15-5-4-6-17(9-15)24-3/h4-6,9,16,18-19H,7-8,10-14H2,1-3H3/t16-,18-,19-/m1/s1 |
| InChIKey | WZODRBYXJRMTOG-BHIYHBOVSA-N |
| XLogP | 1.64 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|