C15H21NO4 — CID 124799707
[(3R,3aR,6aR)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylfuran-2-yl)methanone (PubChem CID 124799707) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(3R,3aR,6aR)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylfuran-2-yl)methanone.
| Compound Name | [(3R,3aR,6aR)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 124799707 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [(3R,3aR,6aR)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(5-methylfuran-2-yl)methanone |
| SMILES | COCC[C@H]1CO[C@H]2CN(C(=O)c3ccc(C)o3)C[C@@H]12 |
| InChI | InChI=1S/C15H21NO4/c1-10-3-4-13(20-10)15(17)16-7-12-11(5-6-18-2)9-19-14(12)8-16/h3-4,11-12,14H,5-9H2,1-2H3/t11-,12-,14-/m0/s1 |
| InChIKey | PQSMAJLXPQDMIE-OBJOEFQTSA-N |
| XLogP | 1.71 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |