C18H24N2O4 — CID 155871829
(3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-methylfuran-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide (PubChem CID 155871829) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-methylfuran-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide.
| Compound Name | (3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-methylfuran-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155871829 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-methylfuran-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
| SMILES | Cc1ccc(C(=O)N2C[C@H](C(=O)NCC3CC3)[C@@H]3CCO[C@@H]3C2)o1 |
| InChI | InChI=1S/C18H24N2O4/c1-11-2-5-15(24-11)18(22)20-9-14(13-6-7-23-16(13)10-20)17(21)19-8-12-3-4-12/h2,5,12-14,16H,3-4,6-10H2,1H3,(H,19,21)/t13-,14-,16+/m0/s1 |
| InChIKey | RZHCFWCEHQPTLE-OFQRWUPVSA-N |
| XLogP | 1.59 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |