C19H25F3N2O4S — CID 155863180
(3aS,4S,7aS)-N-(cyclopropylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155863180) has the molecular formula C19H25F3N2O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is (3aS,4S,7aS)-N-(cyclopropylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,4S,7aS)-N-(cyclopropylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155863180 |
| Molecular Formula | C19H25F3N2O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (3aS,4S,7aS)-N-(cyclopropylmethyl)-6-(thiophen-3-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC1CC1)[C@@H]1CN(Cc2ccsc2)C[C@H]2OCC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2O2S.C2HF3O2/c20-17(18-7-12-1-2-12)15-9-19(8-13-4-6-22-11-13)10-16-14(15)3-5-21-16;3-2(4,5)1(6)7/h4,6,11-12,14-16H,1-3,5,7-10H2,(H,18,20);(H,6,7)/t14-,15+,16+;/m0./s1 |
| InChIKey | YFQTWEJZTKTFAO-FUQNERGOSA-N |
| XLogP | 2.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |