C19H21F3N4O4S — CID 155853274
N-[[(3R,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155853274) has the molecular formula C19H21F3N4O4S and a molecular weight of 458.46 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3R,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853274 |
| Molecular Formula | C19H21F3N4O4S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@@H]1CO[C@@H]2CN(Cc3ccsc3)C[C@H]12)c1cnccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N4O2S.C2HF3O2/c22-17(15-6-18-2-3-19-15)20-5-13-10-23-16-9-21(8-14(13)16)7-12-1-4-24-11-12;3-2(4,5)1(6)7/h1-4,6,11,13-14,16H,5,7-10H2,(H,20,22);(H,6,7)/t13-,14-,16-;/m1./s1 |
| InChIKey | IXIFMCILPTUFDF-CAGYDGFTSA-N |
| XLogP | 2.05 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |