C18H21N3O2S — CID 97482678
2-[(3S,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide (PubChem CID 97482678) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[(3S,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[(3S,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 97482678 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[(3S,3aS,6aS)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide |
| SMILES | O=C(C[C@@H]1CO[C@@H]2CN(Cc3ccsc3)C[C@H]12)Nc1cccnc1 |
| InChI | InChI=1S/C18H21N3O2S/c22-18(20-15-2-1-4-19-7-15)6-14-11-23-17-10-21(9-16(14)17)8-13-3-5-24-12-13/h1-5,7,12,14,16-17H,6,8-11H2,(H,20,22)/t14-,16-,17-/m1/s1 |
| InChIKey | ZIEWPJMHAIPWEB-DJIMGWMZSA-N |
| XLogP | 2.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |