C18H22FN3O3 — CID 131683370
2-[(3R,3aS,6aS)-5-(1-fluorocyclobutanecarbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide (PubChem CID 131683370) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[(3R,3aS,6aS)-5-(1-fluorocyclobutanecarbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[(3R,3aS,6aS)-5-(1-fluorocyclobutanecarbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 131683370 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[(3R,3aS,6aS)-5-(1-fluorocyclobutanecarbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-N-pyridin-3-ylacetamide |
| SMILES | O=C(C[C@H]1CO[C@@H]2CN(C(=O)C3(F)CCC3)C[C@H]12)Nc1cccnc1 |
| InChI | InChI=1S/C18H22FN3O3/c19-18(4-2-5-18)17(24)22-9-14-12(11-25-15(14)10-22)7-16(23)21-13-3-1-6-20-8-13/h1,3,6,8,12,14-15H,2,4-5,7,9-11H2,(H,21,23)/t12-,14+,15+/m0/s1 |
| InChIKey | PQSFJKBCSVFVOJ-NWANDNLSSA-N |
| XLogP | 1.78 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |