C17H23N3O3 — CID 97486367
(3R,3aS,6aS)-5-(oxan-4-yl)-N-pyridin-3-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide (PubChem CID 97486367) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-(oxan-4-yl)-N-pyridin-3-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide.
| Compound Name | (3R,3aS,6aS)-5-(oxan-4-yl)-N-pyridin-3-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 97486367 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (3R,3aS,6aS)-5-(oxan-4-yl)-N-pyridin-3-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)[C@H]1CO[C@@H]2CN(C3CCOCC3)C[C@H]12 |
| InChI | InChI=1S/C17H23N3O3/c21-17(19-12-2-1-5-18-8-12)15-11-23-16-10-20(9-14(15)16)13-3-6-22-7-4-13/h1-2,5,8,13-16H,3-4,6-7,9-11H2,(H,19,21)/t14-,15+,16-/m1/s1 |
| InChIKey | WEWVRURSLPUSCG-OWCLPIDISA-N |
| XLogP | 1.15 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |