C18H25N3O2 — CID 97364670
(3aR,7R,7aR)-2-cyclopentyl-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 97364670) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (3aR,7R,7aR)-2-cyclopentyl-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aR,7R,7aR)-2-cyclopentyl-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 97364670 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (3aR,7R,7aR)-2-cyclopentyl-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | O=C(Nc1cccnc1)[C@H]1COC[C@H]2CN(C3CCCC3)C[C@H]21 |
| InChI | InChI=1S/C18H25N3O2/c22-18(20-14-4-3-7-19-8-14)17-12-23-11-13-9-21(10-16(13)17)15-5-1-2-6-15/h3-4,7-8,13,15-17H,1-2,5-6,9-12H2,(H,20,22)/t13-,16-,17+/m1/s1 |
| InChIKey | CJLOEOJBIOBKSB-XYPHTWIQSA-N |
| XLogP | 2.16 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |