C16H18N6O2 — CID 124781757
(3aS,7S,7aS)-N-pyrazin-2-yl-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 124781757) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (3aS,7S,7aS)-N-pyrazin-2-yl-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aS,7S,7aS)-N-pyrazin-2-yl-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 124781757 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3aS,7S,7aS)-N-pyrazin-2-yl-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | O=C(Nc1cnccn1)[C@@H]1COC[C@@H]2CN(c3ncccn3)C[C@@H]21 |
| InChI | InChI=1S/C16H18N6O2/c23-15(21-14-6-17-4-5-18-14)13-10-24-9-11-7-22(8-12(11)13)16-19-2-1-3-20-16/h1-6,11-13H,7-10H2,(H,18,21,23)/t11-,12-,13+/m0/s1 |
| InChIKey | LWLKGYOBIYPKBG-RWMBFGLXSA-N |
| XLogP | 0.60 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |