C17H23FN4O2 — CID 97364683
[(3aR,7R,7aR)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone (PubChem CID 97364683) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is [(3aR,7R,7aR)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone.
| Compound Name | [(3aR,7R,7aR)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 97364683 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(3aR,7R,7aR)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(4-fluoropiperidin-1-yl)methanone |
| SMILES | O=C([C@H]1COC[C@H]2CN(c3ncccn3)C[C@H]21)N1CCC(F)CC1 |
| InChI | InChI=1S/C17H23FN4O2/c18-13-2-6-21(7-3-13)16(23)15-11-24-10-12-8-22(9-14(12)15)17-19-4-1-5-20-17/h1,4-5,12-15H,2-3,6-11H2/t12-,14-,15+/m1/s1 |
| InChIKey | XURDFWGQDPQFQI-YUELXQCFSA-N |
| XLogP | 1.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |