C21H27N3O3 — CID 131689993
(3aR,7S,7aR)-2-(1-methylcyclohex-3-ene-1-carbonyl)-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 131689993) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (3aR,7S,7aR)-2-(1-methylcyclohex-3-ene-1-carbonyl)-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aR,7S,7aR)-2-(1-methylcyclohex-3-ene-1-carbonyl)-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 131689993 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3aR,7S,7aR)-2-(1-methylcyclohex-3-ene-1-carbonyl)-N-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | CC1(C(=O)N2C[C@@H]3COC[C@@H](C(=O)Nc4cccnc4)[C@@H]3C2)CC=CCC1 |
| InChI | InChI=1S/C21H27N3O3/c1-21(7-3-2-4-8-21)20(26)24-11-15-13-27-14-18(17(15)12-24)19(25)23-16-6-5-9-22-10-16/h2-3,5-6,9-10,15,17-18H,4,7-8,11-14H2,1H3,(H,23,25)/t15-,17-,18-,21?/m1/s1 |
| InChIKey | BSYUZXLHXVJJON-GWRCBPMCSA-N |
| XLogP | 2.49 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|