C23H30F6N2O7 — CID 155852015
(3R,3aR,6aR)-5-(oxan-4-yl)-3-[2-(pyridin-3-ylmethoxy)ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155852015) has the molecular formula C23H30F6N2O7 and a molecular weight of 560.49 g/mol. Its IUPAC name is (3R,3aR,6aR)-5-(oxan-4-yl)-3-[2-(pyridin-3-ylmethoxy)ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aR,6aR)-5-(oxan-4-yl)-3-[2-(pyridin-3-ylmethoxy)ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155852015 |
| Molecular Formula | C23H30F6N2O7 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (3R,3aR,6aR)-5-(oxan-4-yl)-3-[2-(pyridin-3-ylmethoxy)ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(COCC[C@H]2CO[C@H]3CN(C4CCOCC4)C[C@@H]23)c1 |
| InChI | InChI=1S/C19H28N2O3.2C2HF3O2/c1-2-15(10-20-6-1)13-23-7-3-16-14-24-19-12-21(11-18(16)19)17-4-8-22-9-5-17;2*3-2(4,5)1(6)7/h1-2,6,10,16-19H,3-5,7-9,11-14H2;2*(H,6,7)/t16-,18-,19-;;/m0../s1 |
| InChIKey | NZKUPVRDQYZLJT-YLKODNMASA-N |
| XLogP | 3.38 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|