C20H25F4NO4S — CID 155848240
(3S,3aS,6aS)-3-[(2-fluorophenoxy)methyl]-5-(thian-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155848240) has the molecular formula C20H25F4NO4S and a molecular weight of 451.48 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-[(2-fluorophenoxy)methyl]-5-(thian-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,3aS,6aS)-3-[(2-fluorophenoxy)methyl]-5-(thian-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848240 |
| Molecular Formula | C20H25F4NO4S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (3S,3aS,6aS)-3-[(2-fluorophenoxy)methyl]-5-(thian-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Fc1ccccc1OC[C@@H]1CO[C@@H]2CN(C3CCSCC3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24FNO2S.C2HF3O2/c19-16-3-1-2-4-17(16)21-11-13-12-22-18-10-20(9-15(13)18)14-5-7-23-8-6-14;3-2(4,5)1(6)7/h1-4,13-15,18H,5-12H2;(H,6,7)/t13-,15-,18-;/m1./s1 |
| InChIKey | XMDMKQMTWZJREC-ZRCLMYKLSA-N |
| XLogP | 3.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |