C23H24F6N2O6 — CID 155848203
(3S,3aS,6aS)-3-(phenoxymethyl)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848203) has the molecular formula C23H24F6N2O6 and a molecular weight of 538.44 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-(phenoxymethyl)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S,3aS,6aS)-3-(phenoxymethyl)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848203 |
| Molecular Formula | C23H24F6N2O6 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (3S,3aS,6aS)-3-(phenoxymethyl)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(OC[C@@H]2CO[C@@H]3CN(Cc4ccncc4)C[C@H]23)cc1 |
| InChI | InChI=1S/C19H22N2O2.2C2HF3O2/c1-2-4-17(5-3-1)22-13-16-14-23-19-12-21(11-18(16)19)10-15-6-8-20-9-7-15;2*3-2(4,5)1(6)7/h1-9,16,18-19H,10-14H2;2*(H,6,7)/t16-,18-,19-;;/m1../s1 |
| InChIKey | AQBIRDOIULNBSH-KHZNEEPTSA-N |
| XLogP | 3.87 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |