C21H24F3N3O5S — CID 171693507
N-[[(3S,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 171693507) has the molecular formula C21H24F3N3O5S and a molecular weight of 487.50 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171693507 |
| Molecular Formula | C21H24F3N3O5S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(NC[C@H]1CO[C@@H]2CN(Cc3ccccn3)C[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3S.C2HF3O2/c23-26(24,17-7-2-1-3-8-17)21-10-15-14-25-19-13-22(12-18(15)19)11-16-6-4-5-9-20-16;3-2(4,5)1(6)7/h1-9,15,18-19,21H,10-14H2;(H,6,7)/t15-,18+,19+;/m0./s1 |
| InChIKey | OLLQVEKLWGHTNE-GSDGHZPYSA-N |
| XLogP | 2.14 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |