C18H22N2O3S2 — CID 124776614
N-[[(3R,3aR,6aR)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide (PubChem CID 124776614) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[[(3R,3aR,6aR)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[(3R,3aR,6aR)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124776614 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[[(3R,3aR,6aR)-5-(thiophen-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H]1CO[C@H]2CN(Cc3ccsc3)C[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3S2/c21-25(22,16-4-2-1-3-5-16)19-8-15-12-23-18-11-20(10-17(15)18)9-14-6-7-24-13-14/h1-7,13,15,17-19H,8-12H2/t15-,17+,18+/m1/s1 |
| InChIKey | JWOIASXNCHAIBW-NJAFHUGGSA-N |
| XLogP | 2.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |