C15H21F3N2O5S2 — CID 155849434
N-[[(3S,3aS,6aS)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155849434) has the molecular formula C15H21F3N2O5S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849434 |
| Molecular Formula | C15H21F3N2O5S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)NC[C@H]1CO[C@@H]2CN(Cc3cccs3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N2O3S2.C2HF3O2/c1-20(16,17)14-5-10-9-18-13-8-15(7-12(10)13)6-11-3-2-4-19-11;3-2(4,5)1(6)7/h2-4,10,12-14H,5-9H2,1H3;(H,6,7)/t10-,12+,13+;/m0./s1 |
| InChIKey | RZLVYNLEAKCQNC-JJZGMWGRSA-N |
| XLogP | 1.38 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |