C18H20F3N3O4S2 — CID 155848128
N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155848128) has the molecular formula C18H20F3N3O4S2 and a molecular weight of 463.50 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848128 |
| Molecular Formula | C18H20F3N3O4S2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@H]1CO[C@@H]2CN(Cc3nccs3)C[C@H]12)c1ccsc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H19N3O2S2.C2HF3O2/c20-16(11-1-3-22-10-11)18-5-12-9-21-14-7-19(6-13(12)14)8-15-17-2-4-23-15;3-2(4,5)1(6)7/h1-4,10,12-14H,5-9H2,(H,18,20);(H,6,7)/t12-,13+,14+;/m0./s1 |
| InChIKey | GQCCCZOTOFOWBN-SOIKFHLCSA-N |
| XLogP | 2.71 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |