C18H22N4O2S — CID 124804382
N-[[(3R,3aR,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide (PubChem CID 124804382) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[[(3R,3aR,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[(3R,3aR,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124804382 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[[(3R,3aR,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide |
| SMILES | Cc1csc(CN2C[C@H]3[C@H](CNC(=O)c4cccnc4)CO[C@H]3C2)n1 |
| InChI | InChI=1S/C18H22N4O2S/c1-12-11-25-17(21-12)9-22-7-15-14(10-24-16(15)8-22)6-20-18(23)13-3-2-4-19-5-13/h2-5,11,14-16H,6-10H2,1H3,(H,20,23)/t14-,15+,16+/m1/s1 |
| InChIKey | UCVLGTGZJVTLKR-PMPSAXMXSA-N |
| XLogP | 1.72 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |