C16H23N3O2 — CID 124809118
N-[[(3S,3aS,6aS)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide (PubChem CID 124809118) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[(3S,3aS,6aS)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124809118 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridine-3-carboxamide |
| SMILES | CC(C)N1C[C@@H]2[C@@H](CNC(=O)c3cccnc3)CO[C@@H]2C1 |
| InChI | InChI=1S/C16H23N3O2/c1-11(2)19-8-14-13(10-21-15(14)9-19)7-18-16(20)12-4-3-5-17-6-12/h3-6,11,13-15H,7-10H2,1-2H3,(H,18,20)/t13-,14+,15+/m0/s1 |
| InChIKey | WHGMAWRLLNAQHR-RRFJBIMHSA-N |
| XLogP | 1.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |