C17H21N3O2S2 — CID 124811741
N-[[(3S,3aR,6aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide (PubChem CID 124811741) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[[(3S,3aR,6aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[(3S,3aR,6aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 124811741 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[[(3S,3aR,6aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide |
| SMILES | Cc1ncsc1CN1C[C@H]2[C@@H](CNC(=O)c3ccsc3)CO[C@H]2C1 |
| InChI | InChI=1S/C17H21N3O2S2/c1-11-16(24-10-19-11)7-20-5-14-13(8-22-15(14)6-20)4-18-17(21)12-2-3-23-9-12/h2-3,9-10,13-15H,4-8H2,1H3,(H,18,21)/t13-,14-,15-/m0/s1 |
| InChIKey | UFDLKTMUDONVGS-KKUMJFAQSA-N |
| XLogP | 2.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |