C18H18F4N4O4S — CID 155844158
N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155844158) has the molecular formula C18H18F4N4O4S and a molecular weight of 462.43 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844158 |
| Molecular Formula | C18H18F4N4O4S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@H]1CO[C@@H]2CN(c3ncc(F)cn3)C[C@H]12)c1ccsc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H17FN4O2S.C2HF3O2/c17-12-4-19-16(20-5-12)21-6-13-11(8-23-14(13)7-21)3-18-15(22)10-1-2-24-9-10;3-2(4,5)1(6)7/h1-2,4-5,9,11,13-14H,3,6-8H2,(H,18,22);(H,6,7)/t11-,13+,14+;/m0./s1 |
| InChIKey | LTIHJGRESURDOI-IRIHETDOSA-N |
| XLogP | 2.19 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |