C19H22F4N4O4S — CID 155852511
(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155852511) has the molecular formula C19H22F4N4O4S and a molecular weight of 478.47 g/mol. Its IUPAC name is (3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852511 |
| Molecular Formula | C19H22F4N4O4S |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | (3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COCC[C@H]2CO[C@H]3CN(c4ncc(F)cn4)C[C@@H]23)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21FN4O2S.C2HF3O2/c1-11-21-14(10-25-11)9-23-3-2-12-8-24-16-7-22(6-15(12)16)17-19-4-13(18)5-20-17;3-2(4,5)1(6)7/h4-5,10,12,15-16H,2-3,6-9H2,1H3;(H,6,7)/t12-,15-,16-;/m0./s1 |
| InChIKey | IQFJASJKDGMMFW-VMESOOAKSA-N |
| XLogP | 3.07 |
| TPSA | 97.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|