C22H25F6N3O6S — CID 155833991
(3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5-(pyridin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155833991) has the molecular formula C22H25F6N3O6S and a molecular weight of 573.51 g/mol. Its IUPAC name is (3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5-(pyridin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5-(pyridin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155833991 |
| Molecular Formula | C22H25F6N3O6S |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | (3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5-(pyridin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(COC[C@]23COC[C@H]2CN(Cc2ccncc2)C3)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O2S.2C2HF3O2/c1-14-20-17(10-24-14)9-23-13-18-11-21(7-16(18)8-22-12-18)6-15-2-4-19-5-3-15;2*3-2(4,5)1(6)7/h2-5,10,16H,6-9,11-13H2,1H3;2*(H,6,7)/t16-,18+;;/m1../s1 |
| InChIKey | PMUWEHKNMSAFPM-UFUZANHXSA-N |
| XLogP | 3.78 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |